C27H35F2NO3 — CID 10600010
ethyl 2-[(3S,4S)-1-[4-[(2-fluorophenyl)-(4-fluorophenyl)methoxy]butyl]-3-methylpiperidin-4-yl]acetate (PubChem CID 10600010) has the molecular formula C27H35F2NO3 and a molecular weight of 459.58 g/mol. Its IUPAC name is ethyl 2-[(3S,4S)-1-[4-[(2-fluorophenyl)-(4-fluorophenyl)methoxy]butyl]-3-methylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-[(3S,4S)-1-[4-[(2-fluorophenyl)-(4-fluorophenyl)methoxy]butyl]-3-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 10600010 |
| Molecular Formula | C27H35F2NO3 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | ethyl 2-[(3S,4S)-1-[4-[(2-fluorophenyl)-(4-fluorophenyl)methoxy]butyl]-3-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCN(CCCCOC(c2ccc(F)cc2)c2ccccc2F)C[C@H]1C |
| InChI | InChI=1S/C27H35F2NO3/c1-3-32-26(31)18-22-14-16-30(19-20(22)2)15-6-7-17-33-27(21-10-12-23(28)13-11-21)24-8-4-5-9-25(24)29/h4-5,8-13,20,22,27H,3,6-7,14-19H2,1-2H3/t20-,22+,27?/m1/s1 |
| InChIKey | RLSZMICRGQOJAO-LCLQCJHTSA-N |
| XLogP | 5.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|