C29H39F2NO3 — CID 19094159
ethyl 7-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]heptanoate (PubChem CID 19094159) has the molecular formula C29H39F2NO3 and a molecular weight of 487.63 g/mol. Its IUPAC name is ethyl 7-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]heptanoate.
| Compound Name | ethyl 7-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]heptanoate |
|---|---|
| PubChem CID | 19094159 |
| Molecular Formula | C29H39F2NO3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | ethyl 7-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCC1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H39F2NO3/c1-2-34-28(33)8-6-4-3-5-7-23-17-19-32(20-18-23)21-22-35-29(24-9-13-26(30)14-10-24)25-11-15-27(31)16-12-25/h9-16,23,29H,2-8,17-22H2,1H3 |
| InChIKey | MJKKZZBADUKRMS-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|