C30H37F2NO3 — CID 54062144
ethyl 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octa-2,4-dienoate (PubChem CID 54062144) has the molecular formula C30H37F2NO3 and a molecular weight of 497.63 g/mol. Its IUPAC name is ethyl 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octa-2,4-dienoate.
| Compound Name | ethyl 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octa-2,4-dienoate |
|---|---|
| PubChem CID | 54062144 |
| Molecular Formula | C30H37F2NO3 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | ethyl 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octa-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=CCCCC1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H37F2NO3/c1-2-35-29(34)9-7-5-3-4-6-8-24-18-20-33(21-19-24)22-23-36-30(25-10-14-27(31)15-11-25)26-12-16-28(32)17-13-26/h3,5,7,9-17,24,30H,2,4,6,8,18-23H2,1H3 |
| InChIKey | MALUDGFNPLNPHN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|