C28H37F2NO3 — CID 67750378
8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octanoic acid (PubChem CID 67750378) has the molecular formula C28H37F2NO3 and a molecular weight of 473.60 g/mol. Its IUPAC name is 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octanoic acid.
| Compound Name | 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octanoic acid |
|---|---|
| PubChem CID | 67750378 |
| Molecular Formula | C28H37F2NO3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 8-[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]octanoic acid |
| SMILES | O=C(O)CCCCCCCC1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H37F2NO3/c29-25-12-8-23(9-13-25)28(24-10-14-26(30)15-11-24)34-21-20-31-18-16-22(17-19-31)6-4-2-1-3-5-7-27(32)33/h8-15,22,28H,1-7,16-21H2,(H,32,33) |
| InChIKey | IPMGEZVOEURKRK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|