C28H37F2NO3 — CID 67750275
ethyl 2-[[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]methyl]pentanoate (PubChem CID 67750275) has the molecular formula C28H37F2NO3 and a molecular weight of 473.60 g/mol. Its IUPAC name is ethyl 2-[[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]methyl]pentanoate.
| Compound Name | ethyl 2-[[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]methyl]pentanoate |
|---|---|
| PubChem CID | 67750275 |
| Molecular Formula | C28H37F2NO3 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | ethyl 2-[[1-[2-[bis(4-fluorophenyl)methoxy]ethyl]piperidin-4-yl]methyl]pentanoate |
| SMILES | CCCC(CC1CCN(CCOC(c2ccc(F)cc2)c2ccc(F)cc2)CC1)C(=O)OCC |
| InChI | InChI=1S/C28H37F2NO3/c1-3-5-24(28(32)33-4-2)20-21-14-16-31(17-15-21)18-19-34-27(22-6-10-25(29)11-7-22)23-8-12-26(30)13-9-23/h6-13,21,24,27H,3-5,14-20H2,1-2H3 |
| InChIKey | VXCQXDQQEMEZKU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |