C25H35Cl2FN2O3 — CID 70625738
ethyl 3-[4-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]piperazin-1-yl]propanoate;dihydrochloride (PubChem CID 70625738) has the molecular formula C25H35Cl2FN2O3 and a molecular weight of 501.47 g/mol. Its IUPAC name is ethyl 3-[4-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]piperazin-1-yl]propanoate;dihydrochloride.
| Compound Name | ethyl 3-[4-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]piperazin-1-yl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 70625738 |
| Molecular Formula | C25H35Cl2FN2O3 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | ethyl 3-[4-[3-[(4-fluorophenyl)-phenylmethoxy]propyl]piperazin-1-yl]propanoate;dihydrochloride |
| SMILES | CCOC(=O)CCN1CCN(CCCOC(c2ccccc2)c2ccc(F)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C25H33FN2O3.2ClH/c1-2-30-24(29)13-15-28-18-16-27(17-19-28)14-6-20-31-25(21-7-4-3-5-8-21)22-9-11-23(26)12-10-22;;/h3-5,7-12,25H,2,6,13-20H2,1H3;2*1H |
| InChIKey | PTVLESMASBHZAS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|