C25H32ClF2NO3 — CID 67903111
methyl 6-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]hexanoate;hydrochloride (PubChem CID 67903111) has the molecular formula C25H32ClF2NO3 and a molecular weight of 467.98 g/mol. Its IUPAC name is methyl 6-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]hexanoate;hydrochloride.
| Compound Name | methyl 6-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 67903111 |
| Molecular Formula | C25H32ClF2NO3 |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | methyl 6-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]hexanoate;hydrochloride |
| SMILES | COC(=O)CCCCCN1CCC(OC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C25H31F2NO3.ClH/c1-30-24(29)5-3-2-4-16-28-17-14-23(15-18-28)31-25(19-6-10-21(26)11-7-19)20-8-12-22(27)13-9-20;/h6-13,23,25H,2-5,14-18H2,1H3;1H |
| InChIKey | PBXOBLJVLRHSQQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|