C23H25F2NO5 — CID 67831676
4-[bis(4-fluorophenyl)methoxy]-1-methylpiperidine;but-2-enedioic acid (PubChem CID 67831676) has the molecular formula C23H25F2NO5 and a molecular weight of 433.45 g/mol. Its IUPAC name is 4-[bis(4-fluorophenyl)methoxy]-1-methylpiperidine;but-2-enedioic acid.
| Compound Name | 4-[bis(4-fluorophenyl)methoxy]-1-methylpiperidine;but-2-enedioic acid |
|---|---|
| PubChem CID | 67831676 |
| Molecular Formula | C23H25F2NO5 |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[bis(4-fluorophenyl)methoxy]-1-methylpiperidine;but-2-enedioic acid |
| SMILES | CN1CCC(OC(c2ccc(F)cc2)c2ccc(F)cc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H21F2NO.C4H4O4/c1-22-12-10-18(11-13-22)23-19(14-2-6-16(20)7-3-14)15-4-8-17(21)9-5-15;5-3(6)1-2-4(7)8/h2-9,18-19H,10-13H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RMDQLYLUDBPMAC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|