C16H25FN2O — CID 142061545
ethane;2-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)acetamide (PubChem CID 142061545) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is ethane;2-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | ethane;2-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 142061545 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethane;2-(4-fluorophenyl)-2-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CC.CN1CCC(C(C(N)=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H19FN2O.C2H6/c1-17-8-6-11(7-9-17)13(14(16)18)10-2-4-12(15)5-3-10;1-2/h2-5,11,13H,6-9H2,1H3,(H2,16,18);1-2H3 |
| InChIKey | JAQGMWXEOFSBJV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |