C32H43NO7 — CID 67903218
but-2-enedioic acid;6-[4-[(4-tert-butylphenyl)-phenylmethoxy]piperidin-1-yl]hexanoic acid (PubChem CID 67903218) has the molecular formula C32H43NO7 and a molecular weight of 553.70 g/mol. Its IUPAC name is but-2-enedioic acid;6-[4-[(4-tert-butylphenyl)-phenylmethoxy]piperidin-1-yl]hexanoic acid.
| Compound Name | but-2-enedioic acid;6-[4-[(4-tert-butylphenyl)-phenylmethoxy]piperidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 67903218 |
| Molecular Formula | C32H43NO7 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | but-2-enedioic acid;6-[4-[(4-tert-butylphenyl)-phenylmethoxy]piperidin-1-yl]hexanoic acid |
| SMILES | CC(C)(C)c1ccc(C(OC2CCN(CCCCCC(=O)O)CC2)c2ccccc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C28H39NO3.C4H4O4/c1-28(2,3)24-15-13-23(14-16-24)27(22-10-6-4-7-11-22)32-25-17-20-29(21-18-25)19-9-5-8-12-26(30)31;5-3(6)1-2-4(7)8/h4,6-7,10-11,13-16,25,27H,5,8-9,12,17-21H2,1-3H3,(H,30,31);1-2H,(H,5,6)(H,7,8) |
| InChIKey | NBGMECCKTIGFQX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|