C34H41N5O6 — CID 22989274
6-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]-2-tert-butyl-[1,2,4]triazolo[1,5-b]pyridazine;(E)-but-2-enedioic acid (PubChem CID 22989274) has the molecular formula C34H41N5O6 and a molecular weight of 615.73 g/mol. Its IUPAC name is 6-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]-2-tert-butyl-[1,2,4]triazolo[1,5-b]pyridazine;(E)-but-2-enedioic acid.
| Compound Name | 6-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]-2-tert-butyl-[1,2,4]triazolo[1,5-b]pyridazine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 22989274 |
| Molecular Formula | C34H41N5O6 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | 6-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]-2-tert-butyl-[1,2,4]triazolo[1,5-b]pyridazine;(E)-but-2-enedioic acid |
| SMILES | CC(C)(C)c1nc2ccc(OCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)nn2n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H37N5O2.C4H4O4/c1-30(2,3)29-31-26-15-16-27(32-35(26)33-29)36-22-10-19-34-20-17-25(18-21-34)37-28(23-11-6-4-7-12-23)24-13-8-5-9-14-24;5-3(6)1-2-4(7)8/h4-9,11-16,25,28H,10,17-22H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VNSBRJCRHWBTIA-WLHGVMLRSA-N |
| XLogP | 5.17 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|