C32H42NO6P — CID 67421040
4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butan-1-one;phosphoric acid (PubChem CID 67421040) has the molecular formula C32H42NO6P and a molecular weight of 567.66 g/mol. Its IUPAC name is 4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butan-1-one;phosphoric acid.
| Compound Name | 4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butan-1-one;phosphoric acid |
|---|---|
| PubChem CID | 67421040 |
| Molecular Formula | C32H42NO6P |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butan-1-one;phosphoric acid |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C32H39NO2.H3O4P/c1-32(2,3)28-18-16-25(17-19-28)30(34)15-10-22-33-23-20-29(21-24-33)35-31(26-11-6-4-7-12-26)27-13-8-5-9-14-27;1-5(2,3)4/h4-9,11-14,16-19,29,31H,10,15,20-24H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | YRIKMGRCWTVHEP-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|