C27H37NO3 — CID 139601792
7-[4-[(4-ethylphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid (PubChem CID 139601792) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 7-[4-[(4-ethylphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid.
| Compound Name | 7-[4-[(4-ethylphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 139601792 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 7-[4-[(4-ethylphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid |
| SMILES | CCc1ccc(C(OC2CCN(CCCCCCC(=O)O)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H37NO3/c1-2-22-13-15-24(16-14-22)27(23-10-6-5-7-11-23)31-25-17-20-28(21-18-25)19-9-4-3-8-12-26(29)30/h5-7,10-11,13-16,25,27H,2-4,8-9,12,17-21H2,1H3,(H,29,30) |
| InChIKey | SVEUBDVBFQZCQV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|