C27H38ClNO3 — CID 67903314
6-[4-[phenyl-(4-propylphenyl)methoxy]piperidin-1-yl]hexanoic acid;hydrochloride (PubChem CID 67903314) has the molecular formula C27H38ClNO3 and a molecular weight of 460.06 g/mol. Its IUPAC name is 6-[4-[phenyl-(4-propylphenyl)methoxy]piperidin-1-yl]hexanoic acid;hydrochloride.
| Compound Name | 6-[4-[phenyl-(4-propylphenyl)methoxy]piperidin-1-yl]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67903314 |
| Molecular Formula | C27H38ClNO3 |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 6-[4-[phenyl-(4-propylphenyl)methoxy]piperidin-1-yl]hexanoic acid;hydrochloride |
| SMILES | CCCc1ccc(C(OC2CCN(CCCCCC(=O)O)CC2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C27H37NO3.ClH/c1-2-9-22-13-15-24(16-14-22)27(23-10-5-3-6-11-23)31-25-17-20-28(21-18-25)19-8-4-7-12-26(29)30;/h3,5-6,10-11,13-16,25,27H,2,4,7-9,12,17-21H2,1H3,(H,29,30);1H |
| InChIKey | NZDGJUFSWMXYEI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|