C34H41NO6S — CID 70440131
but-2-enedioic acid;1-(4-tert-butylphenyl)-4-[4-[phenyl(thiophen-2-yl)methoxy]piperidin-1-yl]butan-1-one (PubChem CID 70440131) has the molecular formula C34H41NO6S and a molecular weight of 591.77 g/mol. Its IUPAC name is but-2-enedioic acid;1-(4-tert-butylphenyl)-4-[4-[phenyl(thiophen-2-yl)methoxy]piperidin-1-yl]butan-1-one.
| Compound Name | but-2-enedioic acid;1-(4-tert-butylphenyl)-4-[4-[phenyl(thiophen-2-yl)methoxy]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 70440131 |
| Molecular Formula | C34H41NO6S |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | but-2-enedioic acid;1-(4-tert-butylphenyl)-4-[4-[phenyl(thiophen-2-yl)methoxy]piperidin-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3cccs3)CC2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C30H37NO2S.C4H4O4/c1-30(2,3)25-15-13-23(14-16-25)27(32)11-7-19-31-20-17-26(18-21-31)33-29(28-12-8-22-34-28)24-9-5-4-6-10-24;5-3(6)1-2-4(7)8/h4-6,8-10,12-16,22,26,29H,7,11,17-21H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | KTDNWFCPLMJLEG-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|