C33H42N4O — CID 166057240
(1Z)-1-[4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butylidene]guanidine (PubChem CID 166057240) has the molecular formula C33H42N4O and a molecular weight of 510.73 g/mol. Its IUPAC name is (1Z)-1-[4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butylidene]guanidine.
| Compound Name | (1Z)-1-[4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butylidene]guanidine |
|---|---|
| PubChem CID | 166057240 |
| Molecular Formula | C33H42N4O |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | (1Z)-1-[4-(4-benzhydryloxypiperidin-1-yl)-1-(4-tert-butylphenyl)butylidene]guanidine |
| SMILES | [H]/N=C(N)/N=C(/CCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H42N4O/c1-33(2,3)28-18-16-25(17-19-28)30(36-32(34)35)15-10-22-37-23-20-29(21-24-37)38-31(26-11-6-4-7-12-26)27-13-8-5-9-14-27/h4-9,11-14,16-19,29,31H,10,15,20-24H2,1-3H3,(H3,34,35)/b36-30- |
| InChIKey | RWKRKMOVPZDGCS-BBTNWVSFSA-N |
| XLogP | 6.72 |
| TPSA | 74.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|