C31H37N7O4 — CID 22989377
ethyl 2-[[6-[3-(4-benzhydryloxypiperidin-1-yl)propylamino]-[1,2,4]triazolo[1,5-b]pyridazine-2-carbonyl]amino]acetate (PubChem CID 22989377) has the molecular formula C31H37N7O4 and a molecular weight of 571.68 g/mol. Its IUPAC name is ethyl 2-[[6-[3-(4-benzhydryloxypiperidin-1-yl)propylamino]-[1,2,4]triazolo[1,5-b]pyridazine-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[6-[3-(4-benzhydryloxypiperidin-1-yl)propylamino]-[1,2,4]triazolo[1,5-b]pyridazine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 22989377 |
| Molecular Formula | C31H37N7O4 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | ethyl 2-[[6-[3-(4-benzhydryloxypiperidin-1-yl)propylamino]-[1,2,4]triazolo[1,5-b]pyridazine-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1nc2ccc(NCCCN3CCC(OC(c4ccccc4)c4ccccc4)CC3)nn2n1 |
| InChI | InChI=1S/C31H37N7O4/c1-2-41-28(39)22-33-31(40)30-34-27-15-14-26(35-38(27)36-30)32-18-9-19-37-20-16-25(17-21-37)42-29(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-15,25,29H,2,9,16-22H2,1H3,(H,32,35)(H,33,40) |
| InChIKey | FXISNAKKJPUKEZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|