C28H33ClN2O2 — CID 10253913
2-[3-[4-[(4-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propylamino]-4-methylphenol (PubChem CID 10253913) has the molecular formula C28H33ClN2O2 and a molecular weight of 465.04 g/mol. Its IUPAC name is 2-[3-[4-[(4-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propylamino]-4-methylphenol.
| Compound Name | 2-[3-[4-[(4-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propylamino]-4-methylphenol |
|---|---|
| PubChem CID | 10253913 |
| Molecular Formula | C28H33ClN2O2 |
| Molecular Weight | 465.04 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[3-[4-[(4-chlorophenyl)-phenylmethoxy]piperidin-1-yl]propylamino]-4-methylphenol |
| SMILES | Cc1ccc(O)c(NCCCN2CCC(OC(c3ccccc3)c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C28H33ClN2O2/c1-21-8-13-27(32)26(20-21)30-16-5-17-31-18-14-25(15-19-31)33-28(22-6-3-2-4-7-22)23-9-11-24(29)12-10-23/h2-4,6-13,20,25,28,30,32H,5,14-19H2,1H3 |
| InChIKey | ZWEGPAGUJBSLSJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.04 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|