C30H33N5O7 — CID 23000317
1-(4-benzhydryloxypiperidin-1-yl)-3-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)propan-2-ol;(E)-but-2-enedioic acid (PubChem CID 23000317) has the molecular formula C30H33N5O7 and a molecular weight of 575.62 g/mol. Its IUPAC name is 1-(4-benzhydryloxypiperidin-1-yl)-3-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)propan-2-ol;(E)-but-2-enedioic acid.
| Compound Name | 1-(4-benzhydryloxypiperidin-1-yl)-3-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)propan-2-ol;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 23000317 |
| Molecular Formula | C30H33N5O7 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 1-(4-benzhydryloxypiperidin-1-yl)-3-([1,2,4]triazolo[4,3-b]pyridazin-6-yloxy)propan-2-ol;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.OC(COc1ccc2nncn2n1)CN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N5O3.C4H4O4/c32-22(18-33-25-12-11-24-28-27-19-31(24)29-25)17-30-15-13-23(14-16-30)34-26(20-7-3-1-4-8-20)21-9-5-2-6-10-21;5-3(6)1-2-4(7)8/h1-12,19,22-23,26,32H,13-18H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FNAOMNUQKAOIRZ-WLHGVMLRSA-N |
| XLogP | 2.85 |
| TPSA | 159.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|