C28H32F2N2O4S — CID 19776704
N-[2-[3-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide (PubChem CID 19776704) has the molecular formula C28H32F2N2O4S and a molecular weight of 530.64 g/mol. Its IUPAC name is N-[2-[3-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide.
| Compound Name | N-[2-[3-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19776704 |
| Molecular Formula | C28H32F2N2O4S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[2-[3-[4-[bis(4-fluorophenyl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1OCCCN1CCC(OC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H32F2N2O4S/c1-37(33,34)31-26-5-2-3-6-27(26)35-20-4-17-32-18-15-25(16-19-32)36-28(21-7-11-23(29)12-8-21)22-9-13-24(30)14-10-22/h2-3,5-14,25,28,31H,4,15-20H2,1H3 |
| InChIKey | CZYHCACDVDJYLI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|