C33H36N2O4S — CID 19776812
N-[2-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]phenyl]benzenesulfonamide (PubChem CID 19776812) has the molecular formula C33H36N2O4S and a molecular weight of 556.73 g/mol. Its IUPAC name is N-[2-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]phenyl]benzenesulfonamide.
| Compound Name | N-[2-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19776812 |
| Molecular Formula | C33H36N2O4S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-[2-[3-(4-benzhydryloxypiperidin-1-yl)propoxy]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1OCCCN1CCC(OC(c2ccccc2)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C33H36N2O4S/c36-40(37,30-17-8-3-9-18-30)34-31-19-10-11-20-32(31)38-26-12-23-35-24-21-29(22-25-35)39-33(27-13-4-1-5-14-27)28-15-6-2-7-16-28/h1-11,13-20,29,33-34H,12,21-26H2 |
| InChIKey | TWKAGENIKFVUHT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|