C27H33N3O4S — CID 19776705
N-[2-[3-[4-[phenyl(pyridin-4-yl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide (PubChem CID 19776705) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[2-[3-[4-[phenyl(pyridin-4-yl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide.
| Compound Name | N-[2-[3-[4-[phenyl(pyridin-4-yl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19776705 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[2-[3-[4-[phenyl(pyridin-4-yl)methoxy]piperidin-1-yl]propoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1OCCCN1CCC(OC(c2ccccc2)c2ccncc2)CC1 |
| InChI | InChI=1S/C27H33N3O4S/c1-35(31,32)29-25-10-5-6-11-26(25)33-21-7-18-30-19-14-24(15-20-30)34-27(22-8-3-2-4-9-22)23-12-16-28-17-13-23/h2-6,8-13,16-17,24,27,29H,7,14-15,18-21H2,1H3 |
| InChIKey | ICZXQQLQKGEBDY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|