C25H28Cl2N2O3S — CID 174454038
N-[2-[[2-[3-(azetidin-1-yl)propoxy]phenyl]methyl]-4-chlorophenyl]benzenesulfonamide;hydrochloride (PubChem CID 174454038) has the molecular formula C25H28Cl2N2O3S and a molecular weight of 507.48 g/mol. Its IUPAC name is N-[2-[[2-[3-(azetidin-1-yl)propoxy]phenyl]methyl]-4-chlorophenyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-[[2-[3-(azetidin-1-yl)propoxy]phenyl]methyl]-4-chlorophenyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 174454038 |
| Molecular Formula | C25H28Cl2N2O3S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[2-[[2-[3-(azetidin-1-yl)propoxy]phenyl]methyl]-4-chlorophenyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Nc1ccc(Cl)cc1Cc1ccccc1OCCCN1CCC1)c1ccccc1 |
| InChI | InChI=1S/C25H27ClN2O3S.ClH/c26-22-12-13-24(27-32(29,30)23-9-2-1-3-10-23)21(19-22)18-20-8-4-5-11-25(20)31-17-7-16-28-14-6-15-28;/h1-5,8-13,19,27H,6-7,14-18H2;1H |
| InChIKey | XGAJMEGEPZOCGQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|