C28H33Cl3N2O3S — CID 22275065
N-(2,5-dichlorophenyl)-1-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]methanesulfonamide;hydrochloride (PubChem CID 22275065) has the molecular formula C28H33Cl3N2O3S and a molecular weight of 584.01 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-1-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]methanesulfonamide;hydrochloride.
| Compound Name | N-(2,5-dichlorophenyl)-1-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22275065 |
| Molecular Formula | C28H33Cl3N2O3S |
| Molecular Weight | 584.01 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | N-(2,5-dichlorophenyl)-1-phenyl-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]methanesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Cc1ccccc1)N(Cc1ccccc1OCCCN1CCCCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C28H32Cl2N2O3S.ClH/c29-25-14-15-26(30)27(20-25)32(36(33,34)22-23-10-3-1-4-11-23)21-24-12-5-6-13-28(24)35-19-9-18-31-16-7-2-8-17-31;/h1,3-6,10-15,20H,2,7-9,16-19,21-22H2;1H |
| InChIKey | QIJPFQPJNYJFMC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.01 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|