C27H29BrF2N2O3S — CID 22276214
4-bromo-N-(2,5-difluorophenyl)-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 22276214) has the molecular formula C27H29BrF2N2O3S and a molecular weight of 579.51 g/mol. Its IUPAC name is 4-bromo-N-(2,5-difluorophenyl)-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-(2,5-difluorophenyl)-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22276214 |
| Molecular Formula | C27H29BrF2N2O3S |
| Molecular Weight | 579.51 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 4-bromo-N-(2,5-difluorophenyl)-N-[[2-(3-piperidin-1-ylpropoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N(Cc1ccccc1OCCCN1CCCCC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C27H29BrF2N2O3S/c28-22-9-12-24(13-10-22)36(33,34)32(26-19-23(29)11-14-25(26)30)20-21-7-2-3-8-27(21)35-18-6-17-31-15-4-1-5-16-31/h2-3,7-14,19H,1,4-6,15-18,20H2 |
| InChIKey | BFFJSTGKJUZWHE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|