C27H30ClN3O5S — CID 70123511
4-[3-[2-[(N-(4-chlorophenyl)sulfonylanilino)methyl]phenoxy]propyl]piperazine-1-carboxylic acid (PubChem CID 70123511) has the molecular formula C27H30ClN3O5S and a molecular weight of 544.07 g/mol. Its IUPAC name is 4-[3-[2-[(N-(4-chlorophenyl)sulfonylanilino)methyl]phenoxy]propyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-[2-[(N-(4-chlorophenyl)sulfonylanilino)methyl]phenoxy]propyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 70123511 |
| Molecular Formula | C27H30ClN3O5S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 4-[3-[2-[(N-(4-chlorophenyl)sulfonylanilino)methyl]phenoxy]propyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(CCCOc2ccccc2CN(c2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O5S/c28-23-11-13-25(14-12-23)37(34,35)31(24-8-2-1-3-9-24)21-22-7-4-5-10-26(22)36-20-6-15-29-16-18-30(19-17-29)27(32)33/h1-5,7-14H,6,15-21H2,(H,32,33) |
| InChIKey | ALIOTDUJJIRJBH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|