C27H29ClN2O4S — CID 22275371
4-chloro-N-[[2-[3-(4-oxopiperidin-1-yl)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide (PubChem CID 22275371) has the molecular formula C27H29ClN2O4S and a molecular weight of 513.06 g/mol. Its IUPAC name is 4-chloro-N-[[2-[3-(4-oxopiperidin-1-yl)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[[2-[3-(4-oxopiperidin-1-yl)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 22275371 |
| Molecular Formula | C27H29ClN2O4S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 4-chloro-N-[[2-[3-(4-oxopiperidin-1-yl)propoxy]phenyl]methyl]-N-phenylbenzenesulfonamide |
| SMILES | O=C1CCN(CCCOc2ccccc2CN(c2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H29ClN2O4S/c28-23-11-13-26(14-12-23)35(32,33)30(24-8-2-1-3-9-24)21-22-7-4-5-10-27(22)34-20-6-17-29-18-15-25(31)16-19-29/h1-5,7-14H,6,15-21H2 |
| InChIKey | ULRLGPPBFLZTLR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|