C24H25ClFNO3S — CID 141028084
4-chloro-N-[[2-(5-fluoropentoxy)phenyl]methyl]-N-phenylbenzenesulfonamide (PubChem CID 141028084) has the molecular formula C24H25ClFNO3S and a molecular weight of 461.99 g/mol. Its IUPAC name is 4-chloro-N-[[2-(5-fluoropentoxy)phenyl]methyl]-N-phenylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[[2-(5-fluoropentoxy)phenyl]methyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 141028084 |
| Molecular Formula | C24H25ClFNO3S |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-chloro-N-[[2-(5-fluoropentoxy)phenyl]methyl]-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N(Cc1ccccc1OCCCCCF)c1ccccc1 |
| InChI | InChI=1S/C24H25ClFNO3S/c25-21-13-15-23(16-14-21)31(28,29)27(22-10-3-1-4-11-22)19-20-9-5-6-12-24(20)30-18-8-2-7-17-26/h1,3-6,9-16H,2,7-8,17-19H2 |
| InChIKey | GXMAPFYUQISPCU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|