C28H24ClF2NO5S2 — CID 22275678
N-[[2-[3-(benzenesulfonyl)propoxy]phenyl]methyl]-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide (PubChem CID 22275678) has the molecular formula C28H24ClF2NO5S2 and a molecular weight of 592.09 g/mol. Its IUPAC name is N-[[2-[3-(benzenesulfonyl)propoxy]phenyl]methyl]-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide.
| Compound Name | N-[[2-[3-(benzenesulfonyl)propoxy]phenyl]methyl]-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22275678 |
| Molecular Formula | C28H24ClF2NO5S2 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.08 |
| IUPAC Name | N-[[2-[3-(benzenesulfonyl)propoxy]phenyl]methyl]-4-chloro-N-(2,5-difluorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(CCCOc1ccccc1CN(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H24ClF2NO5S2/c29-22-11-14-25(15-12-22)39(35,36)32(27-19-23(30)13-16-26(27)31)20-21-7-4-5-10-28(21)37-17-6-18-38(33,34)24-8-2-1-3-9-24/h1-5,7-16,19H,6,17-18,20H2 |
| InChIKey | GPRJUDPBXGYPNH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|