C19H15ClFNO2S — CID 46152460
N-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]benzenesulfonamide (PubChem CID 46152460) has the molecular formula C19H15ClFNO2S and a molecular weight of 375.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]benzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46152460 |
| Molecular Formula | C19H15ClFNO2S |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(2-fluorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccccc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H15ClFNO2S/c20-16-8-6-9-17(13-16)22(14-15-7-4-5-12-19(15)21)25(23,24)18-10-2-1-3-11-18/h1-13H,14H2 |
| InChIKey | ZWOALGYXADNXFX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |