C19H14F3NO2S — CID 46022862
N-[(2,4-difluorophenyl)methyl]-3-fluoro-N-phenylbenzenesulfonamide (PubChem CID 46022862) has the molecular formula C19H14F3NO2S and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-fluoro-N-phenylbenzenesulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-fluoro-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 46022862 |
| Molecular Formula | C19H14F3NO2S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-fluoro-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(F)c1)N(Cc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H14F3NO2S/c20-15-5-4-8-18(11-15)26(24,25)23(17-6-2-1-3-7-17)13-14-9-10-16(21)12-19(14)22/h1-12H,13H2 |
| InChIKey | KNVMWKIKIADWLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |