C18H14FNO2S — CID 23881981
3-fluoro-N,N-diphenylbenzenesulfonamide (PubChem CID 23881981) has the molecular formula C18H14FNO2S and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-fluoro-N,N-diphenylbenzenesulfonamide.
| Compound Name | 3-fluoro-N,N-diphenylbenzenesulfonamide |
|---|---|
| PubChem CID | 23881981 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-fluoro-N,N-diphenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(F)c1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14FNO2S/c19-15-8-7-13-18(14-15)23(21,22)20(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H |
| InChIKey | AXMCZTCBMPUBKK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |