C31H29ClF2N2O5S — CID 22276252
N-[3-[2-[(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)methyl]phenoxy]propyl]-2-methoxy-N-methylbenzamide (PubChem CID 22276252) has the molecular formula C31H29ClF2N2O5S and a molecular weight of 615.10 g/mol. Its IUPAC name is N-[3-[2-[(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)methyl]phenoxy]propyl]-2-methoxy-N-methylbenzamide.
| Compound Name | N-[3-[2-[(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)methyl]phenoxy]propyl]-2-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 22276252 |
| Molecular Formula | C31H29ClF2N2O5S |
| Molecular Weight | 615.10 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | N-[3-[2-[(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)methyl]phenoxy]propyl]-2-methoxy-N-methylbenzamide |
| SMILES | COc1ccccc1C(=O)N(C)CCCOc1ccccc1CN(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClF2N2O5S/c1-35(31(37)26-9-4-6-11-30(26)40-2)18-7-19-41-29-10-5-3-8-22(29)21-36(28-20-24(33)14-17-27(28)34)42(38,39)25-15-12-23(32)13-16-25/h3-6,8-17,20H,7,18-19,21H2,1-2H3 |
| InChIKey | VOPXYLHGQGNYNE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.10 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|