C26H27ClF2N2O4S — CID 22275232
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-N-methylacetamide (PubChem CID 22275232) has the molecular formula C26H27ClF2N2O4S and a molecular weight of 537.03 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-N-methylacetamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 22275232 |
| Molecular Formula | C26H27ClF2N2O4S |
| Molecular Weight | 537.03 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CCCOc1ccccc1C(C)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClF2N2O4S/c1-18(23-7-4-5-8-26(23)35-16-6-15-30(3)19(2)32)31(25-17-21(28)11-14-24(25)29)36(33,34)22-12-9-20(27)10-13-22/h4-5,7-14,17-18H,6,15-16H2,1-3H3 |
| InChIKey | AXARJXHMMAALOD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.03 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|