C30H22ClF7N2O4S — CID 22275659
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 22275659) has the molecular formula C30H22ClF7N2O4S and a molecular weight of 675.02 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 22275659 |
| Molecular Formula | C30H22ClF7N2O4S |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.09 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CC(c1ccccc1OCCCNC(=O)c1c(F)c(F)c(F)c(F)c1F)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H22ClF7N2O4S/c1-16(40(22-15-18(32)9-12-21(22)33)45(42,43)19-10-7-17(31)8-11-19)20-5-2-3-6-23(20)44-14-4-13-39-30(41)24-25(34)27(36)29(38)28(37)26(24)35/h2-3,5-12,15-16H,4,13-14H2,1H3,(H,39,41) |
| InChIKey | NYPDMCWWQGPRQQ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|