C30H25ClF2N4O8S — CID 22275429
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-dinitrobenzamide (PubChem CID 22275429) has the molecular formula C30H25ClF2N4O8S and a molecular weight of 675.07 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 22275429 |
| Molecular Formula | C30H25ClF2N4O8S |
| Molecular Weight | 675.07 g/mol |
| Exact Mass | 674.10 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-dinitrobenzamide |
| SMILES | CC(c1ccccc1OCCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H25ClF2N4O8S/c1-19(35(28-17-22(32)9-12-27(28)33)46(43,44)25-10-7-21(31)8-11-25)26-5-2-3-6-29(26)45-14-4-13-34-30(38)20-15-23(36(39)40)18-24(16-20)37(41)42/h2-3,5-12,15-19H,4,13-14H2,1H3,(H,34,38) |
| InChIKey | GIIHCFXIOWQTRY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.07 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|