C30H25ClF4N2O4S — CID 22275386
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,5-difluorobenzamide (PubChem CID 22275386) has the molecular formula C30H25ClF4N2O4S and a molecular weight of 621.05 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,5-difluorobenzamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 22275386 |
| Molecular Formula | C30H25ClF4N2O4S |
| Molecular Weight | 621.05 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-2,5-difluorobenzamide |
| SMILES | CC(c1ccccc1OCCCNC(=O)c1cc(F)ccc1F)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H25ClF4N2O4S/c1-19(37(28-18-22(33)10-14-27(28)35)42(39,40)23-11-7-20(31)8-12-23)24-5-2-3-6-29(24)41-16-4-15-36-30(38)25-17-21(32)9-13-26(25)34/h2-3,5-14,17-19H,4,15-16H2,1H3,(H,36,38) |
| InChIKey | JTUMJPQLCPYUQG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.05 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|