C31H27ClF4N2O4S — CID 22275392
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-difluoro-N-methylbenzamide (PubChem CID 22275392) has the molecular formula C31H27ClF4N2O4S and a molecular weight of 635.08 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-difluoro-N-methylbenzamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 22275392 |
| Molecular Formula | C31H27ClF4N2O4S |
| Molecular Weight | 635.08 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3,5-difluoro-N-methylbenzamide |
| SMILES | CC(c1ccccc1OCCCN(C)C(=O)c1cc(F)cc(F)c1)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H27ClF4N2O4S/c1-20(38(29-19-23(33)10-13-28(29)36)43(40,41)26-11-8-22(32)9-12-26)27-6-3-4-7-30(27)42-15-5-14-37(2)31(39)21-16-24(34)18-25(35)17-21/h3-4,6-13,16-20H,5,14-15H2,1-2H3 |
| InChIKey | QFFYPTGYXWPIJD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.08 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|