C32H31ClF2N2O5S — CID 22275342
N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3-methoxy-N-methylbenzamide (PubChem CID 22275342) has the molecular formula C32H31ClF2N2O5S and a molecular weight of 629.13 g/mol. Its IUPAC name is N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3-methoxy-N-methylbenzamide.
| Compound Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 22275342 |
| Molecular Formula | C32H31ClF2N2O5S |
| Molecular Weight | 629.13 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | N-[3-[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenoxy]propyl]-3-methoxy-N-methylbenzamide |
| SMILES | COc1cccc(C(=O)N(C)CCCOc2ccccc2C(C)N(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H31ClF2N2O5S/c1-22(37(30-21-25(34)14-17-29(30)35)43(39,40)27-15-12-24(33)13-16-27)28-10-4-5-11-31(28)42-19-7-18-36(2)32(38)23-8-6-9-26(20-23)41-3/h4-6,8-17,20-22H,7,18-19H2,1-3H3 |
| InChIKey | IBVTTYAEVWZNKP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.13 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|