C21H18ClNO5S — CID 19211456
N-(4-chlorophenyl)sulfonyl-3-methoxy-N-(4-methoxyphenyl)benzamide (PubChem CID 19211456) has the molecular formula C21H18ClNO5S and a molecular weight of 431.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-3-methoxy-N-(4-methoxyphenyl)benzamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-3-methoxy-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 19211456 |
| Molecular Formula | C21H18ClNO5S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-3-methoxy-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2cccc(OC)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H18ClNO5S/c1-27-18-10-8-17(9-11-18)23(21(24)15-4-3-5-19(14-15)28-2)29(25,26)20-12-6-16(22)7-13-20/h3-14H,1-2H3 |
| InChIKey | QDEBIHGWFFCOQV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |