C21H14ClNO6S2 — CID 5051207
N-(4-chlorophenyl)sulfonyl-4-methoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide (PubChem CID 5051207) has the molecular formula C21H14ClNO6S2 and a molecular weight of 475.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-4-methoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-4-methoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide |
|---|---|
| PubChem CID | 5051207 |
| Molecular Formula | C21H14ClNO6S2 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.00 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-4-methoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide |
| SMILES | COc1ccc(C(=O)N(c2ccc3oc(=O)sc3c2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H14ClNO6S2/c1-28-16-7-2-13(3-8-16)20(24)23(31(26,27)17-9-4-14(22)5-10-17)15-6-11-18-19(12-15)30-21(25)29-18/h2-12H,1H3 |
| InChIKey | MMEJFGKJUGTCEX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|