C17H15NO7S2 — CID 5122341
N-(2,5-dimethoxyphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide (PubChem CID 5122341) has the molecular formula C17H15NO7S2 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide |
|---|---|
| PubChem CID | 5122341 |
| Molecular Formula | C17H15NO7S2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C(C)=O)c2ccc3oc(=O)sc3c2)c1 |
| InChI | InChI=1S/C17H15NO7S2/c1-10(19)18(11-4-6-13-15(8-11)26-17(20)25-13)27(21,22)16-9-12(23-2)5-7-14(16)24-3/h4-9H,1-3H3 |
| InChIKey | QCQHKYRUVIIDKR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|