C15H10FNO5S2 — CID 1094874
N-(4-fluorophenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide (PubChem CID 1094874) has the molecular formula C15H10FNO5S2 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide |
|---|---|
| PubChem CID | 1094874 |
| Molecular Formula | C15H10FNO5S2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | N-(4-fluorophenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)acetamide |
| SMILES | CC(=O)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FNO5S2/c1-9(18)17(24(20,21)12-5-2-10(16)3-6-12)11-4-7-13-14(8-11)23-15(19)22-13/h2-8H,1H3 |
| InChIKey | RVSWFISFUNOPQT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|