C13H8FNO4S2 — CID 697338
4-fluoro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide (PubChem CID 697338) has the molecular formula C13H8FNO4S2 and a molecular weight of 325.34 g/mol. Its IUPAC name is 4-fluoro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 697338 |
| Molecular Formula | C13H8FNO4S2 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-fluoro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
| SMILES | O=c1oc2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2s1 |
| InChI | InChI=1S/C13H8FNO4S2/c14-8-1-4-10(5-2-8)21(17,18)15-9-3-6-11-12(7-9)20-13(16)19-11/h1-7,15H |
| InChIKey | AWHHFSRPCDUUJR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|