C14H10N2O6S2 — CID 2939868
2-methyl-5-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide (PubChem CID 2939868) has the molecular formula C14H10N2O6S2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2939868 |
| Molecular Formula | C14H10N2O6S2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-methyl-5-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc2oc(=O)sc2c1 |
| InChI | InChI=1S/C14H10N2O6S2/c1-8-2-4-10(16(18)19)7-13(8)24(20,21)15-9-3-5-11-12(6-9)23-14(17)22-11/h2-7,15H,1H3 |
| InChIKey | ZOZOTONYJBKVLQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|