C17H17NO4S2 — CID 7014167
4-tert-butyl-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide (PubChem CID 7014167) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 7014167 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-tert-butyl-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc3oc(=O)sc3c2)cc1 |
| InChI | InChI=1S/C17H17NO4S2/c1-17(2,3)11-4-7-13(8-5-11)24(20,21)18-12-6-9-14-15(10-12)23-16(19)22-14/h4-10,18H,1-3H3 |
| InChIKey | XBVXWABJISYJOU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|