C15H13NO5S2 — CID 1079378
4-ethoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide (PubChem CID 1079378) has the molecular formula C15H13NO5S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-ethoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 1079378 |
| Molecular Formula | C15H13NO5S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 4-ethoxy-N-(2-oxo-1,3-benzoxathiol-5-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc3oc(=O)sc3c2)cc1 |
| InChI | InChI=1S/C15H13NO5S2/c1-2-20-11-4-6-12(7-5-11)23(18,19)16-10-3-8-13-14(9-10)22-15(17)21-13/h3-9,16H,2H2,1H3 |
| InChIKey | UZNBUKKAHAHPGJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|