C16H20N2O3S — CID 167933154
4-tert-butyl-N-(1-methyl-2-oxo-4-pyridinyl)benzenesulfonamide (PubChem CID 167933154) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-tert-butyl-N-(1-methyl-2-oxo-4-pyridinyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(1-methyl-2-oxo-4-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167933154 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-tert-butyl-N-(1-methyl-2-oxo-4-pyridinyl)benzenesulfonamide |
| SMILES | Cn1ccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1=O |
| InChI | InChI=1S/C16H20N2O3S/c1-16(2,3)12-5-7-14(8-6-12)22(20,21)17-13-9-10-18(4)15(19)11-13/h5-11,17H,1-4H3 |
| InChIKey | QPNRJRLJUPLCPK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |