C25H24N2O5S2 — CID 5151513
N-(5-tert-butyl-2,3-dimethylphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide (PubChem CID 5151513) has the molecular formula C25H24N2O5S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-(5-tert-butyl-2,3-dimethylphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide.
| Compound Name | N-(5-tert-butyl-2,3-dimethylphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5151513 |
| Molecular Formula | C25H24N2O5S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-(5-tert-butyl-2,3-dimethylphenyl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C(C)(C)C)cc(S(=O)(=O)N(C(=O)c2cccnc2)c2ccc3oc(=O)sc3c2)c1C |
| InChI | InChI=1S/C25H24N2O5S2/c1-15-11-18(25(3,4)5)12-22(16(15)2)34(30,31)27(23(28)17-7-6-10-26-14-17)19-8-9-20-21(13-19)33-24(29)32-20/h6-14H,1-5H3 |
| InChIKey | LGOHWTMAOCTAMR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|