C23H13BrN2O5S2 — CID 3919619
N-(4-bromonaphthalen-1-yl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide (PubChem CID 3919619) has the molecular formula C23H13BrN2O5S2 and a molecular weight of 541.40 g/mol. Its IUPAC name is N-(4-bromonaphthalen-1-yl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-bromonaphthalen-1-yl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3919619 |
| Molecular Formula | C23H13BrN2O5S2 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | N-(4-bromonaphthalen-1-yl)sulfonyl-N-(2-oxo-1,3-benzoxathiol-5-yl)pyridine-3-carboxamide |
| SMILES | O=C(c1cccnc1)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C23H13BrN2O5S2/c24-18-8-10-21(17-6-2-1-5-16(17)18)33(29,30)26(22(27)14-4-3-11-25-13-14)15-7-9-19-20(12-15)32-23(28)31-19/h1-13H |
| InChIKey | ZGUYNSVVUQTKMO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|